C15H13Cl2N3OS — CID 15954830
N-[4-[(3,5-dichlorophenyl)carbamothioylamino]phenyl]acetamide (PubChem CID 15954830) has the molecular formula C15H13Cl2N3OS and a molecular weight of 354.26 g/mol. Its IUPAC name is N-[4-[(3,5-dichlorophenyl)carbamothioylamino]phenyl]acetamide.
| Compound Name | N-[4-[(3,5-dichlorophenyl)carbamothioylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 15954830 |
| Molecular Formula | C15H13Cl2N3OS |
| Molecular Weight | 354.26 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | N-[4-[(3,5-dichlorophenyl)carbamothioylamino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(NC(=S)Nc2cc(Cl)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C15H13Cl2N3OS/c1-9(21)18-12-2-4-13(5-3-12)19-15(22)20-14-7-10(16)6-11(17)8-14/h2-8H,1H3,(H,18,21)(H2,19,20,22) |
| InChIKey | WGCRMHOOKRFJGC-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.26 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|