C17H15Cl2N3O4S — CID 15907989
2-[4-[(4-acetamidophenyl)carbamothioylamino]-2,6-dichlorophenoxy]acetic acid (PubChem CID 15907989) has the molecular formula C17H15Cl2N3O4S and a molecular weight of 428.30 g/mol. Its IUPAC name is 2-[4-[(4-acetamidophenyl)carbamothioylamino]-2,6-dichlorophenoxy]acetic acid.
| Compound Name | 2-[4-[(4-acetamidophenyl)carbamothioylamino]-2,6-dichlorophenoxy]acetic acid |
|---|---|
| PubChem CID | 15907989 |
| Molecular Formula | C17H15Cl2N3O4S |
| Molecular Weight | 428.30 g/mol |
| Exact Mass | 427.02 |
| IUPAC Name | 2-[4-[(4-acetamidophenyl)carbamothioylamino]-2,6-dichlorophenoxy]acetic acid |
| SMILES | CC(=O)Nc1ccc(NC(=S)Nc2cc(Cl)c(OCC(=O)O)c(Cl)c2)cc1 |
| InChI | InChI=1S/C17H15Cl2N3O4S/c1-9(23)20-10-2-4-11(5-3-10)21-17(27)22-12-6-13(18)16(14(19)7-12)26-8-15(24)25/h2-7H,8H2,1H3,(H,20,23)(H,24,25)(H2,21,22,27) |
| InChIKey | MFQYCZUGKJGRBX-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.30 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|