C19H24ClN5OS — CID 15954892
N-[4-[[3-chloro-4-[2-(dimethylamino)ethylamino]phenyl]carbamothioylamino]phenyl]acetamide (PubChem CID 15954892) has the molecular formula C19H24ClN5OS and a molecular weight of 405.96 g/mol. Its IUPAC name is N-[4-[[3-chloro-4-[2-(dimethylamino)ethylamino]phenyl]carbamothioylamino]phenyl]acetamide.
| Compound Name | N-[4-[[3-chloro-4-[2-(dimethylamino)ethylamino]phenyl]carbamothioylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 15954892 |
| Molecular Formula | C19H24ClN5OS |
| Molecular Weight | 405.96 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | N-[4-[[3-chloro-4-[2-(dimethylamino)ethylamino]phenyl]carbamothioylamino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(NC(=S)Nc2ccc(NCCN(C)C)c(Cl)c2)cc1 |
| InChI | InChI=1S/C19H24ClN5OS/c1-13(26)22-14-4-6-15(7-5-14)23-19(27)24-16-8-9-18(17(20)12-16)21-10-11-25(2)3/h4-9,12,21H,10-11H2,1-3H3,(H,22,26)(H2,23,24,27) |
| InChIKey | FIHKXDPQXUEFBO-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 68.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.96 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|