C18H21ClN4O2S — CID 15954881
N-[4-[[3-chloro-4-[2-hydroxyethyl(methyl)amino]phenyl]carbamothioylamino]phenyl]acetamide (PubChem CID 15954881) has the molecular formula C18H21ClN4O2S and a molecular weight of 392.91 g/mol. Its IUPAC name is N-[4-[[3-chloro-4-[2-hydroxyethyl(methyl)amino]phenyl]carbamothioylamino]phenyl]acetamide.
| Compound Name | N-[4-[[3-chloro-4-[2-hydroxyethyl(methyl)amino]phenyl]carbamothioylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 15954881 |
| Molecular Formula | C18H21ClN4O2S |
| Molecular Weight | 392.91 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | N-[4-[[3-chloro-4-[2-hydroxyethyl(methyl)amino]phenyl]carbamothioylamino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(NC(=S)Nc2ccc(N(C)CCO)c(Cl)c2)cc1 |
| InChI | InChI=1S/C18H21ClN4O2S/c1-12(25)20-13-3-5-14(6-4-13)21-18(26)22-15-7-8-17(16(19)11-15)23(2)9-10-24/h3-8,11,24H,9-10H2,1-2H3,(H,20,25)(H2,21,22,26) |
| InChIKey | DYJXJGIRBLTVQO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.91 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|