C13H16ClF3N2O2 — CID 71857332
N-[3-chloro-4-[3-(2,2,2-trifluoroethoxy)propylamino]phenyl]acetamide (PubChem CID 71857332) has the molecular formula C13H16ClF3N2O2 and a molecular weight of 324.73 g/mol. Its IUPAC name is N-[3-chloro-4-[3-(2,2,2-trifluoroethoxy)propylamino]phenyl]acetamide.
| Compound Name | N-[3-chloro-4-[3-(2,2,2-trifluoroethoxy)propylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 71857332 |
| Molecular Formula | C13H16ClF3N2O2 |
| Molecular Weight | 324.73 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | N-[3-chloro-4-[3-(2,2,2-trifluoroethoxy)propylamino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(NCCCOCC(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C13H16ClF3N2O2/c1-9(20)19-10-3-4-12(11(14)7-10)18-5-2-6-21-8-13(15,16)17/h3-4,7,18H,2,5-6,8H2,1H3,(H,19,20) |
| InChIKey | PGJIDXQMHSQURM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.73 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|