C11H12ClF4NO — CID 54961611
4-chloro-2-fluoro-N-[3-(2,2,2-trifluoroethoxy)propyl]aniline (PubChem CID 54961611) has the molecular formula C11H12ClF4NO and a molecular weight of 285.67 g/mol. Its IUPAC name is 4-chloro-2-fluoro-N-[3-(2,2,2-trifluoroethoxy)propyl]aniline.
| Compound Name | 4-chloro-2-fluoro-N-[3-(2,2,2-trifluoroethoxy)propyl]aniline |
|---|---|
| PubChem CID | 54961611 |
| Molecular Formula | C11H12ClF4NO |
| Molecular Weight | 285.67 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | 4-chloro-2-fluoro-N-[3-(2,2,2-trifluoroethoxy)propyl]aniline |
| SMILES | Fc1cc(Cl)ccc1NCCCOCC(F)(F)F |
| InChI | InChI=1S/C11H12ClF4NO/c12-8-2-3-10(9(13)6-8)17-4-1-5-18-7-11(14,15)16/h2-3,6,17H,1,4-5,7H2 |
| InChIKey | HWLTYDOAFLPVLZ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.67 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|