C11H12Cl2F3NO — CID 55032016
N-[(2,4-dichlorophenyl)methyl]-2-(2,2,2-trifluoroethoxy)ethanamine (PubChem CID 55032016) has the molecular formula C11H12Cl2F3NO and a molecular weight of 302.12 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methyl]-2-(2,2,2-trifluoroethoxy)ethanamine.
| Compound Name | N-[(2,4-dichlorophenyl)methyl]-2-(2,2,2-trifluoroethoxy)ethanamine |
|---|---|
| PubChem CID | 55032016 |
| Molecular Formula | C11H12Cl2F3NO |
| Molecular Weight | 302.12 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]-2-(2,2,2-trifluoroethoxy)ethanamine |
| SMILES | FC(F)(F)COCCNCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H12Cl2F3NO/c12-9-2-1-8(10(13)5-9)6-17-3-4-18-7-11(14,15)16/h1-2,5,17H,3-4,6-7H2 |
| InChIKey | ANKZHUSDMKSAQA-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.12 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|