C9H9Cl2F3N2O — CID 60730538
3,5-dichloro-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyridin-2-amine (PubChem CID 60730538) has the molecular formula C9H9Cl2F3N2O and a molecular weight of 289.08 g/mol. Its IUPAC name is 3,5-dichloro-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyridin-2-amine.
| Compound Name | 3,5-dichloro-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 60730538 |
| Molecular Formula | C9H9Cl2F3N2O |
| Molecular Weight | 289.08 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | 3,5-dichloro-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyridin-2-amine |
| SMILES | FC(F)(F)COCCNc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C9H9Cl2F3N2O/c10-6-3-7(11)8(16-4-6)15-1-2-17-5-9(12,13)14/h3-4H,1-2,5H2,(H,15,16) |
| InChIKey | SIPKLZSNUVXFJI-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.08 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|