C9H11ClF3N3O — CID 63833719
6-chloro-5-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-amine (PubChem CID 63833719) has the molecular formula C9H11ClF3N3O and a molecular weight of 269.65 g/mol. Its IUPAC name is 6-chloro-5-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-amine.
| Compound Name | 6-chloro-5-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 63833719 |
| Molecular Formula | C9H11ClF3N3O |
| Molecular Weight | 269.65 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 6-chloro-5-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-amine |
| SMILES | Cc1c(Cl)ncnc1NCCOCC(F)(F)F |
| InChI | InChI=1S/C9H11ClF3N3O/c1-6-7(10)15-5-16-8(6)14-2-3-17-4-9(11,12)13/h5H,2-4H2,1H3,(H,14,15,16) |
| InChIKey | VLRLSEIMRPLFAX-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.65 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|