C9H14ClN3 — CID 63729913
N-butyl-6-chloro-5-methylpyrimidin-4-amine (PubChem CID 63729913) has the molecular formula C9H14ClN3 and a molecular weight of 199.69 g/mol. Its IUPAC name is N-butyl-6-chloro-5-methylpyrimidin-4-amine.
| Compound Name | N-butyl-6-chloro-5-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 63729913 |
| Molecular Formula | C9H14ClN3 |
| Molecular Weight | 199.69 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | N-butyl-6-chloro-5-methylpyrimidin-4-amine |
| SMILES | CCCCNc1ncnc(Cl)c1C |
| InChI | InChI=1S/C9H14ClN3/c1-3-4-5-11-9-7(2)8(10)12-6-13-9/h6H,3-5H2,1-2H3,(H,11,12,13) |
| InChIKey | AAKIRSKFKLQUSI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.69 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|