C7H10ClN3 — CID 63734594
6-chloro-N-ethyl-5-methylpyrimidin-4-amine (PubChem CID 63734594) has the molecular formula C7H10ClN3 and a molecular weight of 171.63 g/mol. Its IUPAC name is 6-chloro-N-ethyl-5-methylpyrimidin-4-amine.
| Compound Name | 6-chloro-N-ethyl-5-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 63734594 |
| Molecular Formula | C7H10ClN3 |
| Molecular Weight | 171.63 g/mol |
| Exact Mass | 171.06 |
| IUPAC Name | 6-chloro-N-ethyl-5-methylpyrimidin-4-amine |
| SMILES | CCNc1ncnc(Cl)c1C |
| InChI | InChI=1S/C7H10ClN3/c1-3-9-7-5(2)6(8)10-4-11-7/h4H,3H2,1-2H3,(H,9,10,11) |
| InChIKey | GKRNMCWVGAPNJB-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.63 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |