C10H10F3N3OS — CID 60730692
N-[2-(2,2,2-trifluoroethoxy)ethyl]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 60730692) has the molecular formula C10H10F3N3OS and a molecular weight of 277.27 g/mol. Its IUPAC name is N-[2-(2,2,2-trifluoroethoxy)ethyl]thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[2-(2,2,2-trifluoroethoxy)ethyl]thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 60730692 |
| Molecular Formula | C10H10F3N3OS |
| Molecular Weight | 277.27 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | N-[2-(2,2,2-trifluoroethoxy)ethyl]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | FC(F)(F)COCCNc1ncnc2sccc12 |
| InChI | InChI=1S/C10H10F3N3OS/c11-10(12,13)5-17-3-2-14-8-7-1-4-18-9(7)16-6-15-8/h1,4,6H,2-3,5H2,(H,14,15,16) |
| InChIKey | YFXAUPAERGSNPZ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.27 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|