C10H11N3S — CID 43112087
N-(cyclopropylmethyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 43112087) has the molecular formula C10H11N3S and a molecular weight of 205.29 g/mol. Its IUPAC name is N-(cyclopropylmethyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-(cyclopropylmethyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 43112087 |
| Molecular Formula | C10H11N3S |
| Molecular Weight | 205.29 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | N-(cyclopropylmethyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | c1nc(NCC2CC2)c2ccsc2n1 |
| InChI | InChI=1S/C10H11N3S/c1-2-7(1)5-11-9-8-3-4-14-10(8)13-6-12-9/h3-4,6-7H,1-2,5H2,(H,11,12,13) |
| InChIKey | GQMKWVBNMPYIDF-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |