C13H16ClN3S — CID 65029513
N-[(2-chlorocyclohexyl)methyl]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 65029513) has the molecular formula C13H16ClN3S and a molecular weight of 281.81 g/mol. Its IUPAC name is N-[(2-chlorocyclohexyl)methyl]thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(2-chlorocyclohexyl)methyl]thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 65029513 |
| Molecular Formula | C13H16ClN3S |
| Molecular Weight | 281.81 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | N-[(2-chlorocyclohexyl)methyl]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | ClC1CCCCC1CNc1ncnc2sccc12 |
| InChI | InChI=1S/C13H16ClN3S/c14-11-4-2-1-3-9(11)7-15-12-10-5-6-18-13(10)17-8-16-12/h5-6,8-9,11H,1-4,7H2,(H,15,16,17) |
| InChIKey | CZRMNLDPZGQPSO-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.81 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|