About N-cyclobutylthieno[2,3-d]pyrimidin-4-amine
N-cyclobutylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 13038304) has the molecular formula C10H11N3S
and a molecular weight of 205.29 g/mol. Its IUPAC name is N-cyclobutylthieno[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-cyclobutylthieno[2,3-d]pyrimidin-4-amine |
| PubChem CID | 13038304 |
| Molecular Formula | C10H11N3S |
| Molecular Weight | 205.29 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | N-cyclobutylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | c1nc(NC2CCC2)c2ccsc2n1 |
| InChI | InChI=1S/C10H11N3S/c1-2-7(3-1)13-9-8-4-5-14-10(8)12-6-11-9/h4-7H,1-3H2,(H,11,12,13) |
| InChIKey | RKYIPFXXBXGICH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.29 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-cyclobutylthieno[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclobutylthieno[2,3-d]pyrimidin-4-amine?
The IUPAC name of N-cyclobutylthieno[2,3-d]pyrimidin-4-amine (CID 13038304) is N-cyclobutylthieno[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for N-cyclobutylthieno[2,3-d]pyrimidin-4-amine?
The canonical SMILES for N-cyclobutylthieno[2,3-d]pyrimidin-4-amine is c1nc(NC2CCC2)c2ccsc2n1.
What is the InChIKey of N-cyclobutylthieno[2,3-d]pyrimidin-4-amine?
The InChIKey is RKYIPFXXBXGICH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3S/c1-2-7(3-1)13-9-8-4-5-14-10(8)12-6-11-9/h4-7H,1-3H2,(H,11,12,13).
What are the key properties of N-cyclobutylthieno[2,3-d]pyrimidin-4-amine?
N-cyclobutylthieno[2,3-d]pyrimidin-4-amine has a molecular weight of 205.29 g/mol, XLogP of 2.66, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclobutylthieno[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 13038304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).