C22H32N4S — CID 90925941
N-(1-benzylpiperidin-4-yl)thieno[2,3-d]pyrimidin-4-amine;ethane (PubChem CID 90925941) has the molecular formula C22H32N4S and a molecular weight of 384.59 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)thieno[2,3-d]pyrimidin-4-amine;ethane.
| Compound Name | N-(1-benzylpiperidin-4-yl)thieno[2,3-d]pyrimidin-4-amine;ethane |
|---|---|
| PubChem CID | 90925941 |
| Molecular Formula | C22H32N4S |
| Molecular Weight | 384.59 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)thieno[2,3-d]pyrimidin-4-amine;ethane |
| SMILES | CC.CC.c1ccc(CN2CCC(Nc3ncnc4sccc34)CC2)cc1 |
| InChI | InChI=1S/C18H20N4S.2C2H6/c1-2-4-14(5-3-1)12-22-9-6-15(7-10-22)21-17-16-8-11-23-18(16)20-13-19-17;2*1-2/h1-5,8,11,13,15H,6-7,9-10,12H2,(H,19,20,21);2*1-2H3 |
| InChIKey | KDCYHLNWIAEPQV-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.59 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |