C18H18N4OS — CID 125444803
phenyl-[(3S)-3-(thieno[2,3-d]pyrimidin-4-ylamino)piperidin-1-yl]methanone (PubChem CID 125444803) has the molecular formula C18H18N4OS and a molecular weight of 338.44 g/mol. Its IUPAC name is phenyl-[(3S)-3-(thieno[2,3-d]pyrimidin-4-ylamino)piperidin-1-yl]methanone.
| Compound Name | phenyl-[(3S)-3-(thieno[2,3-d]pyrimidin-4-ylamino)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 125444803 |
| Molecular Formula | C18H18N4OS |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | phenyl-[(3S)-3-(thieno[2,3-d]pyrimidin-4-ylamino)piperidin-1-yl]methanone |
| SMILES | O=C(c1ccccc1)N1CCC[C@H](Nc2ncnc3sccc23)C1 |
| InChI | InChI=1S/C18H18N4OS/c23-18(13-5-2-1-3-6-13)22-9-4-7-14(11-22)21-16-15-8-10-24-17(15)20-12-19-16/h1-3,5-6,8,10,12,14H,4,7,9,11H2,(H,19,20,21)/t14-/m0/s1 |
| InChIKey | OPYQYPZEYCNALL-AWEZNQCLSA-N |
| XLogP | 3.41 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |