C11H13N3OS2 — CID 104576554
N-(1-oxothian-4-yl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 104576554) has the molecular formula C11H13N3OS2 and a molecular weight of 267.38 g/mol. Its IUPAC name is N-(1-oxothian-4-yl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-(1-oxothian-4-yl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 104576554 |
| Molecular Formula | C11H13N3OS2 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | N-(1-oxothian-4-yl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | O=S1CCC(Nc2ncnc3sccc23)CC1 |
| InChI | InChI=1S/C11H13N3OS2/c15-17-5-2-8(3-6-17)14-10-9-1-4-16-11(9)13-7-12-10/h1,4,7-8H,2-3,5-6H2,(H,12,13,14) |
| InChIKey | JVJGMTLCSMOUOF-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |