C14H17N3OS2 — CID 71847247
N-(6-oxa-2-thiaspiro[4.5]decan-9-yl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 71847247) has the molecular formula C14H17N3OS2 and a molecular weight of 307.44 g/mol. Its IUPAC name is N-(6-oxa-2-thiaspiro[4.5]decan-9-yl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-(6-oxa-2-thiaspiro[4.5]decan-9-yl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 71847247 |
| Molecular Formula | C14H17N3OS2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | N-(6-oxa-2-thiaspiro[4.5]decan-9-yl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | c1nc(NC2CCOC3(CCSC3)C2)c2ccsc2n1 |
| InChI | InChI=1S/C14H17N3OS2/c1-4-18-14(3-6-19-8-14)7-10(1)17-12-11-2-5-20-13(11)16-9-15-12/h2,5,9-10H,1,3-4,6-8H2,(H,15,16,17) |
| InChIKey | VXUJJNPBNNVUJR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |