C16H23NOS — CID 79897869
N-(4-ethylphenyl)-6-oxa-2-thiaspiro[4.5]decan-9-amine (PubChem CID 79897869) has the molecular formula C16H23NOS and a molecular weight of 277.43 g/mol. Its IUPAC name is N-(4-ethylphenyl)-6-oxa-2-thiaspiro[4.5]decan-9-amine.
| Compound Name | N-(4-ethylphenyl)-6-oxa-2-thiaspiro[4.5]decan-9-amine |
|---|---|
| PubChem CID | 79897869 |
| Molecular Formula | C16H23NOS |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | N-(4-ethylphenyl)-6-oxa-2-thiaspiro[4.5]decan-9-amine |
| SMILES | CCc1ccc(NC2CCOC3(CCSC3)C2)cc1 |
| InChI | InChI=1S/C16H23NOS/c1-2-13-3-5-14(6-4-13)17-15-7-9-18-16(11-15)8-10-19-12-16/h3-6,15,17H,2,7-12H2,1H3 |
| InChIKey | KZMCZQGLJDZSTQ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |