C16H23NO3S2 — CID 125138409
(5R,9R)-N-(2-ethylsulfonylphenyl)-6-oxa-2-thiaspiro[4.5]decan-9-amine (PubChem CID 125138409) has the molecular formula C16H23NO3S2 and a molecular weight of 341.50 g/mol. Its IUPAC name is (5R,9R)-N-(2-ethylsulfonylphenyl)-6-oxa-2-thiaspiro[4.5]decan-9-amine.
| Compound Name | (5R,9R)-N-(2-ethylsulfonylphenyl)-6-oxa-2-thiaspiro[4.5]decan-9-amine |
|---|---|
| PubChem CID | 125138409 |
| Molecular Formula | C16H23NO3S2 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | (5R,9R)-N-(2-ethylsulfonylphenyl)-6-oxa-2-thiaspiro[4.5]decan-9-amine |
| SMILES | CCS(=O)(=O)c1ccccc1N[C@@H]1CCO[C@@]2(CCSC2)C1 |
| InChI | InChI=1S/C16H23NO3S2/c1-2-22(18,19)15-6-4-3-5-14(15)17-13-7-9-20-16(11-13)8-10-21-12-16/h3-6,13,17H,2,7-12H2,1H3/t13-,16+/m1/s1 |
| InChIKey | ZXVXPYWVEBXCNK-CJNGLKHVSA-N |
| XLogP | 2.95 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |