C15H21NO3S2 — CID 79902139
N-(4-methylsulfonylphenyl)-6-oxa-2-thiaspiro[4.5]decan-9-amine (PubChem CID 79902139) has the molecular formula C15H21NO3S2 and a molecular weight of 327.47 g/mol. Its IUPAC name is N-(4-methylsulfonylphenyl)-6-oxa-2-thiaspiro[4.5]decan-9-amine.
| Compound Name | N-(4-methylsulfonylphenyl)-6-oxa-2-thiaspiro[4.5]decan-9-amine |
|---|---|
| PubChem CID | 79902139 |
| Molecular Formula | C15H21NO3S2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | N-(4-methylsulfonylphenyl)-6-oxa-2-thiaspiro[4.5]decan-9-amine |
| SMILES | CS(=O)(=O)c1ccc(NC2CCOC3(CCSC3)C2)cc1 |
| InChI | InChI=1S/C15H21NO3S2/c1-21(17,18)14-4-2-12(3-5-14)16-13-6-8-19-15(10-13)7-9-20-11-15/h2-5,13,16H,6-11H2,1H3 |
| InChIKey | ZGGMGNCDQJYIAP-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |