C15H17N3O3S — CID 124603955
2-nitro-5-[[(5S,9S)-6-oxa-2-thiaspiro[4.5]decan-9-yl]amino]benzonitrile (PubChem CID 124603955) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is 2-nitro-5-[[(5S,9S)-6-oxa-2-thiaspiro[4.5]decan-9-yl]amino]benzonitrile.
| Compound Name | 2-nitro-5-[[(5S,9S)-6-oxa-2-thiaspiro[4.5]decan-9-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 124603955 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 2-nitro-5-[[(5S,9S)-6-oxa-2-thiaspiro[4.5]decan-9-yl]amino]benzonitrile |
| SMILES | N#Cc1cc(N[C@H]2CCO[C@]3(CCSC3)C2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H17N3O3S/c16-9-11-7-12(1-2-14(11)18(19)20)17-13-3-5-21-15(8-13)4-6-22-10-15/h1-2,7,13,17H,3-6,8,10H2/t13-,15+/m0/s1 |
| InChIKey | RUZBEPCUXZIUNG-DZGCQCFKSA-N |
| XLogP | 2.93 |
| TPSA | 88.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|