C13H17N3O3S — CID 97324835
3-nitro-N-[(5S,9R)-6-oxa-2-thiaspiro[4.5]decan-9-yl]pyridin-4-amine (PubChem CID 97324835) has the molecular formula C13H17N3O3S and a molecular weight of 295.36 g/mol. Its IUPAC name is 3-nitro-N-[(5S,9R)-6-oxa-2-thiaspiro[4.5]decan-9-yl]pyridin-4-amine.
| Compound Name | 3-nitro-N-[(5S,9R)-6-oxa-2-thiaspiro[4.5]decan-9-yl]pyridin-4-amine |
|---|---|
| PubChem CID | 97324835 |
| Molecular Formula | C13H17N3O3S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 3-nitro-N-[(5S,9R)-6-oxa-2-thiaspiro[4.5]decan-9-yl]pyridin-4-amine |
| SMILES | O=[N+]([O-])c1cnccc1N[C@@H]1CCO[C@]2(CCSC2)C1 |
| InChI | InChI=1S/C13H17N3O3S/c17-16(18)12-8-14-4-1-11(12)15-10-2-5-19-13(7-10)3-6-20-9-13/h1,4,8,10H,2-3,5-7,9H2,(H,14,15)/t10-,13-/m1/s1 |
| InChIKey | PYVZBDZGTJBLMC-ZWNOBZJWSA-N |
| XLogP | 2.46 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|