C15H20ClNO2S — CID 107621556
N-(4-chloro-3-methoxyphenyl)-6-oxa-2-thiaspiro[4.5]decan-9-amine (PubChem CID 107621556) has the molecular formula C15H20ClNO2S and a molecular weight of 313.85 g/mol. Its IUPAC name is N-(4-chloro-3-methoxyphenyl)-6-oxa-2-thiaspiro[4.5]decan-9-amine.
| Compound Name | N-(4-chloro-3-methoxyphenyl)-6-oxa-2-thiaspiro[4.5]decan-9-amine |
|---|---|
| PubChem CID | 107621556 |
| Molecular Formula | C15H20ClNO2S |
| Molecular Weight | 313.85 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | N-(4-chloro-3-methoxyphenyl)-6-oxa-2-thiaspiro[4.5]decan-9-amine |
| SMILES | COc1cc(NC2CCOC3(CCSC3)C2)ccc1Cl |
| InChI | InChI=1S/C15H20ClNO2S/c1-18-14-8-11(2-3-13(14)16)17-12-4-6-19-15(9-12)5-7-20-10-15/h2-3,8,12,17H,4-7,9-10H2,1H3 |
| InChIKey | BYHUAVADVOZVDN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.85 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |