C15H19N3O2 — CID 115500441
5-[(3,3-dimethylcyclohexyl)amino]-2-nitrobenzonitrile (PubChem CID 115500441) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 5-[(3,3-dimethylcyclohexyl)amino]-2-nitrobenzonitrile.
| Compound Name | 5-[(3,3-dimethylcyclohexyl)amino]-2-nitrobenzonitrile |
|---|---|
| PubChem CID | 115500441 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 5-[(3,3-dimethylcyclohexyl)amino]-2-nitrobenzonitrile |
| SMILES | CC1(C)CCCC(Nc2ccc([N+](=O)[O-])c(C#N)c2)C1 |
| InChI | InChI=1S/C15H19N3O2/c1-15(2)7-3-4-13(9-15)17-12-5-6-14(18(19)20)11(8-12)10-16/h5-6,8,13,17H,3-4,7,9H2,1-2H3 |
| InChIKey | WFTMDOQBMSCNJP-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|