3-[(3,3-dimethylcyclopentyl)amino]-4-nitrobenzoic acid

C14H18N2O4 — CID 114541271

IUPAC3-[(3,3-dimethylcyclopentyl)amino]-4-nitrobenzoic acid
SMILESCC1(C)CCC(Nc2cc(C(=O)O)ccc2[N+](=O)[O-])C1
InChIInChI=1S/C14H18N2O4/c1-14(2)6-5-10(8-14)15-11-7-9(13(17)18)3-4-12(11)16(19)20/h3-4,7,10,15H,5-6,8H2,1-2H3,(H,17,18)
InChIKeyBAOJPCDFNSPRIW-UHFFFAOYSA-N
MW278.31 g/mol
LogP3.28
Rot. Bonds4

About 3-[(3,3-dimethylcyclopentyl)amino]-4-nitrobenzoic acid

3-[(3,3-dimethylcyclopentyl)amino]-4-nitrobenzoic acid (PubChem CID 114541271) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 3-[(3,3-dimethylcyclopentyl)amino]-4-nitrobenzoic acid.

Molecular Properties

Compound Name3-[(3,3-dimethylcyclopentyl)amino]-4-nitrobenzoic acid
PubChem CID114541271
Molecular FormulaC14H18N2O4
Molecular Weight278.31 g/mol
Exact Mass278.13
IUPAC Name3-[(3,3-dimethylcyclopentyl)amino]-4-nitrobenzoic acid
SMILESCC1(C)CCC(Nc2cc(C(=O)O)ccc2[N+](=O)[O-])C1
InChIInChI=1S/C14H18N2O4/c1-14(2)6-5-10(8-14)15-11-7-9(13(17)18)3-4-12(11)16(19)20/h3-4,7,10,15H,5-6,8H2,1-2H3,(H,17,18)
InChIKeyBAOJPCDFNSPRIW-UHFFFAOYSA-N
XLogP3.28
TPSA92.47 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500278.31
LogP ≤ 53.28
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 3-[(3,3-dimethylcyclopentyl)amino]-4-nitrobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(3,3-dimethylcyclopentyl)amino]-4-nitrobenzoic acid?
The IUPAC name of 3-[(3,3-dimethylcyclopentyl)amino]-4-nitrobenzoic acid (CID 114541271) is 3-[(3,3-dimethylcyclopentyl)amino]-4-nitrobenzoic acid.
What is the SMILES notation for 3-[(3,3-dimethylcyclopentyl)amino]-4-nitrobenzoic acid?
The canonical SMILES for 3-[(3,3-dimethylcyclopentyl)amino]-4-nitrobenzoic acid is CC1(C)CCC(Nc2cc(C(=O)O)ccc2[N+](=O)[O-])C1.
What is the InChIKey of 3-[(3,3-dimethylcyclopentyl)amino]-4-nitrobenzoic acid?
The InChIKey is BAOJPCDFNSPRIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O4/c1-14(2)6-5-10(8-14)15-11-7-9(13(17)18)3-4-12(11)16(19)20/h3-4,7,10,15H,5-6,8H2,1-2H3,(H,17,18).
What are the key properties of 3-[(3,3-dimethylcyclopentyl)amino]-4-nitrobenzoic acid?
3-[(3,3-dimethylcyclopentyl)amino]-4-nitrobenzoic acid has a molecular weight of 278.31 g/mol, XLogP of 3.28, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,3-dimethylcyclopentyl)amino]-4-nitrobenzoic acid is sourced from PubChem (CID 114541271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).