C13H16BrFN2O2 — CID 114547961
5-bromo-N-(3,3-dimethylcyclopentyl)-4-fluoro-2-nitroaniline (PubChem CID 114547961) has the molecular formula C13H16BrFN2O2 and a molecular weight of 331.19 g/mol. Its IUPAC name is 5-bromo-N-(3,3-dimethylcyclopentyl)-4-fluoro-2-nitroaniline.
| Compound Name | 5-bromo-N-(3,3-dimethylcyclopentyl)-4-fluoro-2-nitroaniline |
|---|---|
| PubChem CID | 114547961 |
| Molecular Formula | C13H16BrFN2O2 |
| Molecular Weight | 331.19 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 5-bromo-N-(3,3-dimethylcyclopentyl)-4-fluoro-2-nitroaniline |
| SMILES | CC1(C)CCC(Nc2cc(Br)c(F)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C13H16BrFN2O2/c1-13(2)4-3-8(7-13)16-11-5-9(14)10(15)6-12(11)17(18)19/h5-6,8,16H,3-4,7H2,1-2H3 |
| InChIKey | IXUNDZWWWBUEAQ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.19 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|