C15H21FN2O3 — CID 107260322
N-(4,4-dimethylcyclohexyl)-2-fluoro-5-methoxy-4-nitroaniline (PubChem CID 107260322) has the molecular formula C15H21FN2O3 and a molecular weight of 296.34 g/mol. Its IUPAC name is N-(4,4-dimethylcyclohexyl)-2-fluoro-5-methoxy-4-nitroaniline.
| Compound Name | N-(4,4-dimethylcyclohexyl)-2-fluoro-5-methoxy-4-nitroaniline |
|---|---|
| PubChem CID | 107260322 |
| Molecular Formula | C15H21FN2O3 |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | N-(4,4-dimethylcyclohexyl)-2-fluoro-5-methoxy-4-nitroaniline |
| SMILES | COc1cc(NC2CCC(C)(C)CC2)c(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H21FN2O3/c1-15(2)6-4-10(5-7-15)17-12-9-14(21-3)13(18(19)20)8-11(12)16/h8-10,17H,4-7H2,1-3H3 |
| InChIKey | SESNDAMSWQXBJH-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|