C13H17FN2O4 — CID 103867526
2-[(2-fluoro-5-methoxy-4-nitroanilino)methyl]cyclopentan-1-ol (PubChem CID 103867526) has the molecular formula C13H17FN2O4 and a molecular weight of 284.29 g/mol. Its IUPAC name is 2-[(2-fluoro-5-methoxy-4-nitroanilino)methyl]cyclopentan-1-ol.
| Compound Name | 2-[(2-fluoro-5-methoxy-4-nitroanilino)methyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 103867526 |
| Molecular Formula | C13H17FN2O4 |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 2-[(2-fluoro-5-methoxy-4-nitroanilino)methyl]cyclopentan-1-ol |
| SMILES | COc1cc(NCC2CCCC2O)c(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H17FN2O4/c1-20-13-6-10(9(14)5-11(13)16(18)19)15-7-8-3-2-4-12(8)17/h5-6,8,12,15,17H,2-4,7H2,1H3 |
| InChIKey | LXZWQCWPZFXDJY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|