C12H18FN3O3 — CID 102809457
1-N-(2-fluoro-5-methoxy-4-nitrophenyl)-2-N,2-N-dimethylpropane-1,2-diamine (PubChem CID 102809457) has the molecular formula C12H18FN3O3 and a molecular weight of 271.29 g/mol. Its IUPAC name is 1-N-(2-fluoro-5-methoxy-4-nitrophenyl)-2-N,2-N-dimethylpropane-1,2-diamine.
| Compound Name | 1-N-(2-fluoro-5-methoxy-4-nitrophenyl)-2-N,2-N-dimethylpropane-1,2-diamine |
|---|---|
| PubChem CID | 102809457 |
| Molecular Formula | C12H18FN3O3 |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 1-N-(2-fluoro-5-methoxy-4-nitrophenyl)-2-N,2-N-dimethylpropane-1,2-diamine |
| SMILES | COc1cc(NCC(C)N(C)C)c(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H18FN3O3/c1-8(15(2)3)7-14-10-6-12(19-4)11(16(17)18)5-9(10)13/h5-6,8,14H,7H2,1-4H3 |
| InChIKey | ATWSENNZWINSPU-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|