C11H14FN3O4 — CID 86802918
N-ethyl-2-(2-fluoro-5-methoxy-4-nitroanilino)acetamide (PubChem CID 86802918) has the molecular formula C11H14FN3O4 and a molecular weight of 271.25 g/mol. Its IUPAC name is N-ethyl-2-(2-fluoro-5-methoxy-4-nitroanilino)acetamide.
| Compound Name | N-ethyl-2-(2-fluoro-5-methoxy-4-nitroanilino)acetamide |
|---|---|
| PubChem CID | 86802918 |
| Molecular Formula | C11H14FN3O4 |
| Molecular Weight | 271.25 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | N-ethyl-2-(2-fluoro-5-methoxy-4-nitroanilino)acetamide |
| SMILES | CCNC(=O)CNc1cc(OC)c([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C11H14FN3O4/c1-3-13-11(16)6-14-8-5-10(19-2)9(15(17)18)4-7(8)12/h4-5,14H,3,6H2,1-2H3,(H,13,16) |
| InChIKey | OOCIIXAVPCPQBA-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.25 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|