C12H15FN2O3S2 — CID 103883449
N-(1,4-dithian-2-ylmethyl)-2-fluoro-5-methoxy-4-nitroaniline (PubChem CID 103883449) has the molecular formula C12H15FN2O3S2 and a molecular weight of 318.40 g/mol. Its IUPAC name is N-(1,4-dithian-2-ylmethyl)-2-fluoro-5-methoxy-4-nitroaniline.
| Compound Name | N-(1,4-dithian-2-ylmethyl)-2-fluoro-5-methoxy-4-nitroaniline |
|---|---|
| PubChem CID | 103883449 |
| Molecular Formula | C12H15FN2O3S2 |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | N-(1,4-dithian-2-ylmethyl)-2-fluoro-5-methoxy-4-nitroaniline |
| SMILES | COc1cc(NCC2CSCCS2)c(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H15FN2O3S2/c1-18-12-5-10(9(13)4-11(12)15(16)17)14-6-8-7-19-2-3-20-8/h4-5,8,14H,2-3,6-7H2,1H3 |
| InChIKey | RHAVHSKHGIJINL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|