C11H13FN2O2S2 — CID 115685340
N-(1,4-dithian-2-ylmethyl)-4-fluoro-2-nitroaniline (PubChem CID 115685340) has the molecular formula C11H13FN2O2S2 and a molecular weight of 288.37 g/mol. Its IUPAC name is N-(1,4-dithian-2-ylmethyl)-4-fluoro-2-nitroaniline.
| Compound Name | N-(1,4-dithian-2-ylmethyl)-4-fluoro-2-nitroaniline |
|---|---|
| PubChem CID | 115685340 |
| Molecular Formula | C11H13FN2O2S2 |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | N-(1,4-dithian-2-ylmethyl)-4-fluoro-2-nitroaniline |
| SMILES | O=[N+]([O-])c1cc(F)ccc1NCC1CSCCS1 |
| InChI | InChI=1S/C11H13FN2O2S2/c12-8-1-2-10(11(5-8)14(15)16)13-6-9-7-17-3-4-18-9/h1-2,5,9,13H,3-4,6-7H2 |
| InChIKey | PQHCYCYWHMGFSP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|