C11H12FN3O3S — CID 82906631
N-(4-fluoro-2-nitrophenyl)thiomorpholine-3-carboxamide (PubChem CID 82906631) has the molecular formula C11H12FN3O3S and a molecular weight of 285.30 g/mol. Its IUPAC name is N-(4-fluoro-2-nitrophenyl)thiomorpholine-3-carboxamide.
| Compound Name | N-(4-fluoro-2-nitrophenyl)thiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 82906631 |
| Molecular Formula | C11H12FN3O3S |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | N-(4-fluoro-2-nitrophenyl)thiomorpholine-3-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1[N+](=O)[O-])C1CSCCN1 |
| InChI | InChI=1S/C11H12FN3O3S/c12-7-1-2-8(10(5-7)15(17)18)14-11(16)9-6-19-4-3-13-9/h1-2,5,9,13H,3-4,6H2,(H,14,16) |
| InChIKey | JOFZIVORYOUNFG-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|