C11H11N3O5S — CID 43703693
N-(6-nitro-1,3-benzodioxol-5-yl)-1,3-thiazolidine-4-carboxamide (PubChem CID 43703693) has the molecular formula C11H11N3O5S and a molecular weight of 297.29 g/mol. Its IUPAC name is N-(6-nitro-1,3-benzodioxol-5-yl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(6-nitro-1,3-benzodioxol-5-yl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 43703693 |
| Molecular Formula | C11H11N3O5S |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | N-(6-nitro-1,3-benzodioxol-5-yl)-1,3-thiazolidine-4-carboxamide |
| SMILES | O=C(Nc1cc2c(cc1[N+](=O)[O-])OCO2)C1CSCN1 |
| InChI | InChI=1S/C11H11N3O5S/c15-11(7-3-20-4-12-7)13-6-1-9-10(19-5-18-9)2-8(6)14(16)17/h1-2,7,12H,3-5H2,(H,13,15) |
| InChIKey | LDADLJNPEGWERK-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|