C12H10N2O7 — CID 60941700
2-[(6-nitro-1,3-benzodioxol-5-yl)carbamoyl]cyclopropane-1-carboxylic acid (PubChem CID 60941700) has the molecular formula C12H10N2O7 and a molecular weight of 294.22 g/mol. Its IUPAC name is 2-[(6-nitro-1,3-benzodioxol-5-yl)carbamoyl]cyclopropane-1-carboxylic acid.
| Compound Name | 2-[(6-nitro-1,3-benzodioxol-5-yl)carbamoyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 60941700 |
| Molecular Formula | C12H10N2O7 |
| Molecular Weight | 294.22 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 2-[(6-nitro-1,3-benzodioxol-5-yl)carbamoyl]cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1CC1C(=O)Nc1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C12H10N2O7/c15-11(5-1-6(5)12(16)17)13-7-2-9-10(21-4-20-9)3-8(7)14(18)19/h2-3,5-6H,1,4H2,(H,13,15)(H,16,17) |
| InChIKey | WBILTCIFLOLCHC-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.22 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|