C13H15N3O5 — CID 81119591
(3R)-N-(6-nitro-1,3-benzodioxol-5-yl)piperidine-3-carboxamide (PubChem CID 81119591) has the molecular formula C13H15N3O5 and a molecular weight of 293.28 g/mol. Its IUPAC name is (3R)-N-(6-nitro-1,3-benzodioxol-5-yl)piperidine-3-carboxamide.
| Compound Name | (3R)-N-(6-nitro-1,3-benzodioxol-5-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 81119591 |
| Molecular Formula | C13H15N3O5 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | (3R)-N-(6-nitro-1,3-benzodioxol-5-yl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1cc2c(cc1[N+](=O)[O-])OCO2)[C@@H]1CCCNC1 |
| InChI | InChI=1S/C13H15N3O5/c17-13(8-2-1-3-14-6-8)15-9-4-11-12(21-7-20-11)5-10(9)16(18)19/h4-5,8,14H,1-3,6-7H2,(H,15,17)/t8-/m1/s1 |
| InChIKey | AUPFTQYRUXILRN-MRVPVSSYSA-N |
| XLogP | 1.26 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|