C11H13N3O4 — CID 79724723
N-(6-nitro-1,3-benzodioxol-5-yl)pyrrolidin-3-amine (PubChem CID 79724723) has the molecular formula C11H13N3O4 and a molecular weight of 251.24 g/mol. Its IUPAC name is N-(6-nitro-1,3-benzodioxol-5-yl)pyrrolidin-3-amine.
| Compound Name | N-(6-nitro-1,3-benzodioxol-5-yl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 79724723 |
| Molecular Formula | C11H13N3O4 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | N-(6-nitro-1,3-benzodioxol-5-yl)pyrrolidin-3-amine |
| SMILES | O=[N+]([O-])c1cc2c(cc1NC1CCNC1)OCO2 |
| InChI | InChI=1S/C11H13N3O4/c15-14(16)9-4-11-10(17-6-18-11)3-8(9)13-7-1-2-12-5-7/h3-4,7,12-13H,1-2,5-6H2 |
| InChIKey | GOIAHDCQLOTIIR-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 85.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|