C11H14ClN3O4 — CID 171194477
(2R)-2-(6-nitro-1,3-benzodioxol-5-yl)piperazine;hydrochloride (PubChem CID 171194477) has the molecular formula C11H14ClN3O4 and a molecular weight of 287.70 g/mol. Its IUPAC name is (2R)-2-(6-nitro-1,3-benzodioxol-5-yl)piperazine;hydrochloride.
| Compound Name | (2R)-2-(6-nitro-1,3-benzodioxol-5-yl)piperazine;hydrochloride |
|---|---|
| PubChem CID | 171194477 |
| Molecular Formula | C11H14ClN3O4 |
| Molecular Weight | 287.70 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | (2R)-2-(6-nitro-1,3-benzodioxol-5-yl)piperazine;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1cc2c(cc1[C@@H]1CNCCN1)OCO2 |
| InChI | InChI=1S/C11H13N3O4.ClH/c15-14(16)9-4-11-10(17-6-18-11)3-7(9)8-5-12-1-2-13-8;/h3-4,8,12-13H,1-2,5-6H2;1H/t8-;/m0./s1 |
| InChIKey | FYMKSPQQUABWOJ-QRPNPIFTSA-N |
| XLogP | 0.98 |
| TPSA | 85.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.70 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|