C11H14N2O2 — CID 2771771
2-(1,3-benzodioxol-5-yl)piperazine (PubChem CID 2771771) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)piperazine.
| Compound Name | 2-(1,3-benzodioxol-5-yl)piperazine |
|---|---|
| PubChem CID | 2771771 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)piperazine |
| SMILES | c1cc2c(cc1C1CNCCN1)OCO2 |
| InChI | InChI=1S/C11H14N2O2/c1-2-10-11(15-7-14-10)5-8(1)9-6-12-3-4-13-9/h1-2,5,9,12-13H,3-4,6-7H2 |
| InChIKey | IFBLQYWVJXGZPY-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |