C11H14ClNO2 — CID 66519216
(2R)-2-(1,3-benzodioxol-5-yl)pyrrolidine;hydrochloride (PubChem CID 66519216) has the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. Its IUPAC name is (2R)-2-(1,3-benzodioxol-5-yl)pyrrolidine;hydrochloride.
| Compound Name | (2R)-2-(1,3-benzodioxol-5-yl)pyrrolidine;hydrochloride |
|---|---|
| PubChem CID | 66519216 |
| Molecular Formula | C11H14ClNO2 |
| Molecular Weight | 227.69 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | (2R)-2-(1,3-benzodioxol-5-yl)pyrrolidine;hydrochloride |
| SMILES | Cl.c1cc2c(cc1[C@H]1CCCN1)OCO2 |
| InChI | InChI=1S/C11H13NO2.ClH/c1-2-9(12-5-1)8-3-4-10-11(6-8)14-7-13-10;/h3-4,6,9,12H,1-2,5,7H2;1H/t9-;/m1./s1 |
| InChIKey | RRCIKUPKYLHKQJ-SBSPUUFOSA-N |
| XLogP | 2.26 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.69 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |