C11H11F2NO2 — CID 66519154
(2S)-2-(2,2-difluoro-1,3-benzodioxol-5-yl)pyrrolidine (PubChem CID 66519154) has the molecular formula C11H11F2NO2 and a molecular weight of 227.21 g/mol. Its IUPAC name is (2S)-2-(2,2-difluoro-1,3-benzodioxol-5-yl)pyrrolidine.
| Compound Name | (2S)-2-(2,2-difluoro-1,3-benzodioxol-5-yl)pyrrolidine |
|---|---|
| PubChem CID | 66519154 |
| Molecular Formula | C11H11F2NO2 |
| Molecular Weight | 227.21 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | (2S)-2-(2,2-difluoro-1,3-benzodioxol-5-yl)pyrrolidine |
| SMILES | FC1(F)Oc2ccc([C@@H]3CCCN3)cc2O1 |
| InChI | InChI=1S/C11H11F2NO2/c12-11(13)15-9-4-3-7(6-10(9)16-11)8-2-1-5-14-8/h3-4,6,8,14H,1-2,5H2/t8-/m0/s1 |
| InChIKey | AOESAXVPUKOBRA-QMMMGPOBSA-N |
| XLogP | 2.43 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.21 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |