C12H17FN2 — CID 58295234
5-(4-fluorophenyl)-1,4-diazocane (PubChem CID 58295234) has the molecular formula C12H17FN2 and a molecular weight of 208.28 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-1,4-diazocane.
| Compound Name | 5-(4-fluorophenyl)-1,4-diazocane |
|---|---|
| PubChem CID | 58295234 |
| Molecular Formula | C12H17FN2 |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | 5-(4-fluorophenyl)-1,4-diazocane |
| SMILES | Fc1ccc(C2CCCNCCN2)cc1 |
| InChI | InChI=1S/C12H17FN2/c13-11-5-3-10(4-6-11)12-2-1-7-14-8-9-15-12/h3-6,12,14-15H,1-2,7-9H2 |
| InChIKey | QNOFQFLLWZKFQV-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |