C11H12ClF2NO2 — CID 169449503
2-(2,2-difluoro-1,3-benzodioxol-5-yl)pyrrolidine;hydrochloride (PubChem CID 169449503) has the molecular formula C11H12ClF2NO2 and a molecular weight of 263.67 g/mol. Its IUPAC name is 2-(2,2-difluoro-1,3-benzodioxol-5-yl)pyrrolidine;hydrochloride.
| Compound Name | 2-(2,2-difluoro-1,3-benzodioxol-5-yl)pyrrolidine;hydrochloride |
|---|---|
| PubChem CID | 169449503 |
| Molecular Formula | C11H12ClF2NO2 |
| Molecular Weight | 263.67 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 2-(2,2-difluoro-1,3-benzodioxol-5-yl)pyrrolidine;hydrochloride |
| SMILES | Cl.FC1(F)Oc2ccc(C3CCCN3)cc2O1 |
| InChI | InChI=1S/C11H11F2NO2.ClH/c12-11(13)15-9-4-3-7(6-10(9)16-11)8-2-1-5-14-8;/h3-4,6,8,14H,1-2,5H2;1H |
| InChIKey | NTJPALVKDGKKMV-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.67 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |