C17H23NO2 — CID 117436350
2-spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylpiperidine (PubChem CID 117436350) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is 2-spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylpiperidine.
| Compound Name | 2-spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylpiperidine |
|---|---|
| PubChem CID | 117436350 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 2-spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylpiperidine |
| SMILES | c1cc2c(cc1C1CCCCN1)OC1(CCCCC1)O2 |
| InChI | InChI=1S/C17H23NO2/c1-3-9-17(10-4-1)19-15-8-7-13(12-16(15)20-17)14-6-2-5-11-18-14/h7-8,12,14,18H,1-6,9-11H2 |
| InChIKey | ZOZCVUSQDFMNGR-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |