About 4-piperidin-2-ylphenol
4-piperidin-2-ylphenol (PubChem CID 19711202) has the molecular formula C11H15NO
and a molecular weight of 177.25 g/mol. Its IUPAC name is 4-piperidin-2-ylphenol.
Molecular Properties
| Compound Name | 4-piperidin-2-ylphenol |
| PubChem CID | 19711202 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 4-piperidin-2-ylphenol |
| SMILES | Oc1ccc(C2CCCCN2)cc1 |
| InChI | InChI=1S/C11H15NO/c13-10-6-4-9(5-7-10)11-3-1-2-8-12-11/h4-7,11-13H,1-3,8H2 |
| InChIKey | YDYOXZKGPNTYAV-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-piperidin-2-ylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-piperidin-2-ylphenol?
The IUPAC name of 4-piperidin-2-ylphenol (CID 19711202) is 4-piperidin-2-ylphenol.
What is the SMILES notation for 4-piperidin-2-ylphenol?
The canonical SMILES for 4-piperidin-2-ylphenol is Oc1ccc(C2CCCCN2)cc1.
What is the InChIKey of 4-piperidin-2-ylphenol?
The InChIKey is YDYOXZKGPNTYAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO/c13-10-6-4-9(5-7-10)11-3-1-2-8-12-11/h4-7,11-13H,1-3,8H2.
What are the key properties of 4-piperidin-2-ylphenol?
4-piperidin-2-ylphenol has a molecular weight of 177.25 g/mol, XLogP of 2.21, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-piperidin-2-ylphenol is sourced from PubChem (CID 19711202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).