About (2S)-2-phenylpiperidine
(2S)-2-phenylpiperidine (PubChem CID 10997356) has the molecular formula C11H15N
and a molecular weight of 161.25 g/mol. Its IUPAC name is (2S)-2-phenylpiperidine.
Molecular Properties
| Compound Name | (2S)-2-phenylpiperidine |
| PubChem CID | 10997356 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | (2S)-2-phenylpiperidine |
| SMILES | c1ccc([C@@H]2CCCCN2)cc1 |
| InChI | InChI=1S/C11H15N/c1-2-6-10(7-3-1)11-8-4-5-9-12-11/h1-3,6-7,11-12H,4-5,8-9H2/t11-/m0/s1 |
| InChIKey | WGIAUTGOUJDVEI-NSHDSACASA-N |
| XLogP | 2.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S)-2-phenylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-phenylpiperidine?
The IUPAC name of (2S)-2-phenylpiperidine (CID 10997356) is (2S)-2-phenylpiperidine.
What is the SMILES notation for (2S)-2-phenylpiperidine?
The canonical SMILES for (2S)-2-phenylpiperidine is c1ccc([C@@H]2CCCCN2)cc1.
What is the InChIKey of (2S)-2-phenylpiperidine?
The InChIKey is WGIAUTGOUJDVEI-NSHDSACASA-N. The full InChI is InChI=1S/C11H15N/c1-2-6-10(7-3-1)11-8-4-5-9-12-11/h1-3,6-7,11-12H,4-5,8-9H2/t11-/m0/s1.
What are the key properties of (2S)-2-phenylpiperidine?
(2S)-2-phenylpiperidine has a molecular weight of 161.25 g/mol, XLogP of 2.50, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-phenylpiperidine is sourced from PubChem (CID 10997356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).