About (5R)-5-phenyl-1,4-diazepane
(5R)-5-phenyl-1,4-diazepane (PubChem CID 124583394) has the molecular formula C11H16N2
and a molecular weight of 176.26 g/mol. Its IUPAC name is (5R)-5-phenyl-1,4-diazepane.
Molecular Properties
| Compound Name | (5R)-5-phenyl-1,4-diazepane |
| PubChem CID | 124583394 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | (5R)-5-phenyl-1,4-diazepane |
| SMILES | c1ccc([C@H]2CCNCCN2)cc1 |
| InChI | InChI=1S/C11H16N2/c1-2-4-10(5-3-1)11-6-7-12-8-9-13-11/h1-5,11-13H,6-9H2/t11-/m1/s1 |
| InChIKey | QCAAXQQWOQRRIO-LLVKDONJSA-N |
| XLogP | 1.31 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5R)-5-phenyl-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-phenyl-1,4-diazepane?
The IUPAC name of (5R)-5-phenyl-1,4-diazepane (CID 124583394) is (5R)-5-phenyl-1,4-diazepane.
What is the SMILES notation for (5R)-5-phenyl-1,4-diazepane?
The canonical SMILES for (5R)-5-phenyl-1,4-diazepane is c1ccc([C@H]2CCNCCN2)cc1.
What is the InChIKey of (5R)-5-phenyl-1,4-diazepane?
The InChIKey is QCAAXQQWOQRRIO-LLVKDONJSA-N. The full InChI is InChI=1S/C11H16N2/c1-2-4-10(5-3-1)11-6-7-12-8-9-13-11/h1-5,11-13H,6-9H2/t11-/m1/s1.
What are the key properties of (5R)-5-phenyl-1,4-diazepane?
(5R)-5-phenyl-1,4-diazepane has a molecular weight of 176.26 g/mol, XLogP of 1.31, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-phenyl-1,4-diazepane is sourced from PubChem (CID 124583394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).