About ethane;(2S)-2-phenylaziridine
ethane;(2S)-2-phenylaziridine (PubChem CID 145185749) has the molecular formula C10H15N
and a molecular weight of 149.24 g/mol. Its IUPAC name is ethane;(2S)-2-phenylaziridine.
Molecular Properties
| Compound Name | ethane;(2S)-2-phenylaziridine |
| PubChem CID | 145185749 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | ethane;(2S)-2-phenylaziridine |
| SMILES | CC.c1ccc([C@H]2CN2)cc1 |
| InChI | InChI=1S/C8H9N.C2H6/c1-2-4-7(5-3-1)8-6-9-8;1-2/h1-5,8-9H,6H2;1-2H3/t8-;/m1./s1 |
| InChIKey | OXPQEMWABIBMKD-DDWIOCJRSA-N |
| XLogP | 2.36 |
| TPSA | 21.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze ethane;(2S)-2-phenylaziridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(2S)-2-phenylaziridine?
The IUPAC name of ethane;(2S)-2-phenylaziridine (CID 145185749) is ethane;(2S)-2-phenylaziridine.
What is the SMILES notation for ethane;(2S)-2-phenylaziridine?
The canonical SMILES for ethane;(2S)-2-phenylaziridine is CC.c1ccc([C@H]2CN2)cc1.
What is the InChIKey of ethane;(2S)-2-phenylaziridine?
The InChIKey is OXPQEMWABIBMKD-DDWIOCJRSA-N. The full InChI is InChI=1S/C8H9N.C2H6/c1-2-4-7(5-3-1)8-6-9-8;1-2/h1-5,8-9H,6H2;1-2H3/t8-;/m1./s1.
What are the key properties of ethane;(2S)-2-phenylaziridine?
ethane;(2S)-2-phenylaziridine has a molecular weight of 149.24 g/mol, XLogP of 2.36, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(2S)-2-phenylaziridine is sourced from PubChem (CID 145185749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).